C17H20O4 — CID 166447953
ethyl (1S,2R,5R,6R)-7,10-dimethyl-3,11-dioxotricyclo[4.4.1.12,5]dodeca-7,9-diene-8-carboxylate (PubChem CID 166447953) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is ethyl (1S,2R,5R,6R)-7,10-dimethyl-3,11-dioxotricyclo[4.4.1.12,5]dodeca-7,9-diene-8-carboxylate.
| Compound Name | ethyl (1S,2R,5R,6R)-7,10-dimethyl-3,11-dioxotricyclo[4.4.1.12,5]dodeca-7,9-diene-8-carboxylate |
|---|---|
| PubChem CID | 166447953 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | ethyl (1S,2R,5R,6R)-7,10-dimethyl-3,11-dioxotricyclo[4.4.1.12,5]dodeca-7,9-diene-8-carboxylate |
| SMILES | CCOC(=O)C1=C(C)[C@@H]2C(=O)[C@H](C(C)=C1)[C@H]1C[C@@H]2CC1=O |
| InChI | InChI=1S/C17H20O4/c1-4-21-17(20)11-5-8(2)14-12-6-10(7-13(12)18)15(9(11)3)16(14)19/h5,10,12,14-15H,4,6-7H2,1-3H3/t10-,12+,14-,15+/m1/s1 |
| InChIKey | ACLQSGDNRQFZJC-BQPHKTIFSA-N |
| XLogP | 2.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |