About 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan
3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan (PubChem CID 166448280) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan.
Molecular Properties
| Compound Name | 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan |
| PubChem CID | 166448280 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan |
| SMILES | Cc1ccccc1[C@@H](C)/C=C/c1ccoc1 |
| InChI | InChI=1S/C15H16O/c1-12-5-3-4-6-15(12)13(2)7-8-14-9-10-16-11-14/h3-11,13H,1-2H3/b8-7+/t13-/m0/s1 |
| InChIKey | DLGCARQDWHUJGA-GWJCSSMESA-N |
| XLogP | 4.40 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan?
The IUPAC name of 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan (CID 166448280) is 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan.
What is the SMILES notation for 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan?
The canonical SMILES for 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan is Cc1ccccc1[C@@H](C)/C=C/c1ccoc1.
What is the InChIKey of 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan?
The InChIKey is DLGCARQDWHUJGA-GWJCSSMESA-N. The full InChI is InChI=1S/C15H16O/c1-12-5-3-4-6-15(12)13(2)7-8-14-9-10-16-11-14/h3-11,13H,1-2H3/b8-7+/t13-/m0/s1.
What are the key properties of 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan?
3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan has a molecular weight of 212.29 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E,3S)-3-(2-methylphenyl)but-1-enyl]furan is sourced from PubChem (CID 166448280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).