C22H29BO4 — CID 166448334
methyl (1R,5S)-5-[(E)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]cyclohex-3-ene-1-carboxylate (PubChem CID 166448334) has the molecular formula C22H29BO4 and a molecular weight of 368.28 g/mol. Its IUPAC name is methyl (1R,5S)-5-[(E)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,5S)-5-[(E)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 166448334 |
| Molecular Formula | C22H29BO4 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | methyl (1R,5S)-5-[(E)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=C[C@@H](/C(=C\B2OC(C)(C)C(C)(C)O2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H29BO4/c1-21(2)22(3,4)27-23(26-21)15-19(16-10-7-6-8-11-16)17-12-9-13-18(14-17)20(24)25-5/h6-12,15,17-18H,13-14H2,1-5H3/b19-15-/t17-,18-/m1/s1 |
| InChIKey | FAGGGPJRRRISMU-UMSXXIAASA-N |
| XLogP | 4.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|