C19H21NO2S2 — CID 166448570
1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 166448570) has the molecular formula C19H21NO2S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 166448570 |
| Molecular Formula | C19H21NO2S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | C=C(C)C1CN(S(=O)(=O)c2ccc(C)cc2)CC=C1c1cccs1 |
| InChI | InChI=1S/C19H21NO2S2/c1-14(2)18-13-20(11-10-17(18)19-5-4-12-23-19)24(21,22)16-8-6-15(3)7-9-16/h4-10,12,18H,1,11,13H2,2-3H3 |
| InChIKey | JAVSVBPBSWLYOI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|