C19H22NO2S2+ — CID 166448571
1-(4-methylphenyl)sulfonyl-3-propan-2-yl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 166448571) has the molecular formula C19H22NO2S2+ and a molecular weight of 360.52 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-propan-2-yl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-propan-2-yl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 166448571 |
| Molecular Formula | C19H22NO2S2+ |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-propan-2-yl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=C(c3cccs3)C([C+](C)C)C2)cc1 |
| InChI | InChI=1S/C19H22NO2S2/c1-14(2)18-13-20(11-10-17(18)19-5-4-12-23-19)24(21,22)16-8-6-15(3)7-9-16/h4-10,12,18H,11,13H2,1-3H3/q+1 |
| InChIKey | DJNCMZXSEAUCJC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|