About trans-(1S,2R)-1-methylcyclobutane-1,2-diol
trans-(1S,2R)-1-methylcyclobutane-1,2-diol (PubChem CID 166448617) has the molecular formula C5H10O2
and a molecular weight of 102.13 g/mol. Its IUPAC name is trans-(1S,2R)-1-methylcyclobutane-1,2-diol.
Molecular Properties
| Compound Name | trans-(1S,2R)-1-methylcyclobutane-1,2-diol |
| PubChem CID | 166448617 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | trans-(1S,2R)-1-methylcyclobutane-1,2-diol |
| SMILES | C[C@]1(O)CC[C@H]1O |
| InChI | InChI=1S/C5H10O2/c1-5(7)3-2-4(5)6/h4,6-7H,2-3H2,1H3/t4-,5+/m1/s1 |
| InChIKey | AUIKLSXVOASOKC-UHNVWZDZSA-N |
| XLogP | -0.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1S,2R)-1-methylcyclobutane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2R)-1-methylcyclobutane-1,2-diol?
The IUPAC name of trans-(1S,2R)-1-methylcyclobutane-1,2-diol (CID 166448617) is trans-(1S,2R)-1-methylcyclobutane-1,2-diol.
What is the SMILES notation for trans-(1S,2R)-1-methylcyclobutane-1,2-diol?
The canonical SMILES for trans-(1S,2R)-1-methylcyclobutane-1,2-diol is C[C@]1(O)CC[C@H]1O.
What is the InChIKey of trans-(1S,2R)-1-methylcyclobutane-1,2-diol?
The InChIKey is AUIKLSXVOASOKC-UHNVWZDZSA-N. The full InChI is InChI=1S/C5H10O2/c1-5(7)3-2-4(5)6/h4,6-7H,2-3H2,1H3/t4-,5+/m1/s1.
What are the key properties of trans-(1S,2R)-1-methylcyclobutane-1,2-diol?
trans-(1S,2R)-1-methylcyclobutane-1,2-diol has a molecular weight of 102.13 g/mol, XLogP of -0.11, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-1-methylcyclobutane-1,2-diol is sourced from PubChem (CID 166448617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).