About 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol
8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol (PubChem CID 166448619) has the molecular formula C13H11FNO+
and a molecular weight of 216.24 g/mol. Its IUPAC name is 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol.
Molecular Properties
| Compound Name | 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol |
| PubChem CID | 166448619 |
| Molecular Formula | C13H11FNO+ |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol |
| SMILES | CC1(O)c2cc(F)ccc2-c2cccc[n+]21 |
| InChI | InChI=1S/C13H11FNO/c1-13(16)11-8-9(14)5-6-10(11)12-4-2-3-7-15(12)13/h2-8,16H,1H3/q+1 |
| InChIKey | ONLUCNOQRLJLAB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol?
The IUPAC name of 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol (CID 166448619) is 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol.
What is the SMILES notation for 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol?
The canonical SMILES for 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol is CC1(O)c2cc(F)ccc2-c2cccc[n+]21.
What is the InChIKey of 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol?
The InChIKey is ONLUCNOQRLJLAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11FNO/c1-13(16)11-8-9(14)5-6-10(11)12-4-2-3-7-15(12)13/h2-8,16H,1H3/q+1.
What are the key properties of 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol?
8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol has a molecular weight of 216.24 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-6-methylpyrido[1,2-b]isoindol-5-ium-6-ol is sourced from PubChem (CID 166448619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).