C9H12NO+ — CID 166448680
2,3,6,7,8,9a-hexahydro-1H-quinolizin-8-ylium-4-one (PubChem CID 166448680) has the molecular formula C9H12NO+ and a molecular weight of 150.20 g/mol. Its IUPAC name is 2,3,6,7,8,9a-hexahydro-1H-quinolizin-8-ylium-4-one.
| Compound Name | 2,3,6,7,8,9a-hexahydro-1H-quinolizin-8-ylium-4-one |
|---|---|
| PubChem CID | 166448680 |
| Molecular Formula | C9H12NO+ |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 2,3,6,7,8,9a-hexahydro-1H-quinolizin-8-ylium-4-one |
| SMILES | O=C1CCCC2C=[C+]CCN12 |
| InChI | InChI=1S/C9H12NO/c11-9-6-3-5-8-4-1-2-7-10(8)9/h4,8H,2-3,5-7H2/q+1 |
| InChIKey | ARVAXKURGSRCHP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|