C31H35BFNO2 — CID 166448789
2-[4-[(1Z,4Z)-2-fluoro-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,4-dienyl]phenyl]pyridine (PubChem CID 166448789) has the molecular formula C31H35BFNO2 and a molecular weight of 483.44 g/mol. Its IUPAC name is 2-[4-[(1Z,4Z)-2-fluoro-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,4-dienyl]phenyl]pyridine.
| Compound Name | 2-[4-[(1Z,4Z)-2-fluoro-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,4-dienyl]phenyl]pyridine |
|---|---|
| PubChem CID | 166448789 |
| Molecular Formula | C31H35BFNO2 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 2-[4-[(1Z,4Z)-2-fluoro-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,4-dienyl]phenyl]pyridine |
| SMILES | CCC/C(B1OC(C)(C)C(C)(C)O1)=C(/C/C(F)=C/c1ccc(-c2ccccn2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H35BFNO2/c1-6-12-28(32-35-30(2,3)31(4,5)36-32)27(24-13-8-7-9-14-24)22-26(33)21-23-16-18-25(19-17-23)29-15-10-11-20-34-29/h7-11,13-21H,6,12,22H2,1-5H3/b26-21-,28-27+ |
| InChIKey | DVGKKBCLIHWKED-DOQHNZKESA-N |
| XLogP | 8.33 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|