C18H32O4Si — CID 166448824
2-[(3R,3aR)-3,6,7,7-tetramethyl-5-oxo-6-trimethylsilyloxy-2,3,4,7a-tetrahydro-1H-inden-3a-yl]acetic acid (PubChem CID 166448824) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is 2-[(3R,3aR)-3,6,7,7-tetramethyl-5-oxo-6-trimethylsilyloxy-2,3,4,7a-tetrahydro-1H-inden-3a-yl]acetic acid.
| Compound Name | 2-[(3R,3aR)-3,6,7,7-tetramethyl-5-oxo-6-trimethylsilyloxy-2,3,4,7a-tetrahydro-1H-inden-3a-yl]acetic acid |
|---|---|
| PubChem CID | 166448824 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 2-[(3R,3aR)-3,6,7,7-tetramethyl-5-oxo-6-trimethylsilyloxy-2,3,4,7a-tetrahydro-1H-inden-3a-yl]acetic acid |
| SMILES | C[C@@H]1CCC2C(C)(C)C(C)(O[Si](C)(C)C)C(=O)C[C@]21CC(=O)O |
| InChI | InChI=1S/C18H32O4Si/c1-12-8-9-13-16(2,3)17(4,22-23(5,6)7)14(19)10-18(12,13)11-15(20)21/h12-13H,8-11H2,1-7H3,(H,20,21)/t12-,13?,17?,18-/m1/s1 |
| InChIKey | WZWOETJOVTXZNL-AEYXLDPTSA-N |
| XLogP | 4.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|