C16H24O4 — CID 166448830
(1R,5S,10R)-5-(methoxymethyl)-4,5,10-trimethyl-7-oxatricyclo[4.3.3.01,6]dodecane-3,8-dione (PubChem CID 166448830) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (1R,5S,10R)-5-(methoxymethyl)-4,5,10-trimethyl-7-oxatricyclo[4.3.3.01,6]dodecane-3,8-dione.
| Compound Name | (1R,5S,10R)-5-(methoxymethyl)-4,5,10-trimethyl-7-oxatricyclo[4.3.3.01,6]dodecane-3,8-dione |
|---|---|
| PubChem CID | 166448830 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (1R,5S,10R)-5-(methoxymethyl)-4,5,10-trimethyl-7-oxatricyclo[4.3.3.01,6]dodecane-3,8-dione |
| SMILES | COC[C@]1(C)C(C)C(=O)C[C@]23CC(=O)OC21CC[C@H]3C |
| InChI | InChI=1S/C16H24O4/c1-10-5-6-16-14(3,9-19-4)11(2)12(17)7-15(10,16)8-13(18)20-16/h10-11H,5-9H2,1-4H3/t10-,11?,14-,15-,16?/m1/s1 |
| InChIKey | BOXVZRQRXTYNDW-VPLCKUOPSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |