C16H26O4 — CID 166448831
2-[(3R,3aR,7S)-7-(methoxymethyl)-3,6,7-trimethyl-5-oxo-1,2,3,4,6,7a-hexahydroinden-3a-yl]acetic acid (PubChem CID 166448831) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[(3R,3aR,7S)-7-(methoxymethyl)-3,6,7-trimethyl-5-oxo-1,2,3,4,6,7a-hexahydroinden-3a-yl]acetic acid.
| Compound Name | 2-[(3R,3aR,7S)-7-(methoxymethyl)-3,6,7-trimethyl-5-oxo-1,2,3,4,6,7a-hexahydroinden-3a-yl]acetic acid |
|---|---|
| PubChem CID | 166448831 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-[(3R,3aR,7S)-7-(methoxymethyl)-3,6,7-trimethyl-5-oxo-1,2,3,4,6,7a-hexahydroinden-3a-yl]acetic acid |
| SMILES | COC[C@]1(C)C(C)C(=O)C[C@]2(CC(=O)O)C1CC[C@H]2C |
| InChI | InChI=1S/C16H26O4/c1-10-5-6-13-15(3,9-20-4)11(2)12(17)7-16(10,13)8-14(18)19/h10-11,13H,5-9H2,1-4H3,(H,18,19)/t10-,11?,13?,15-,16-/m1/s1 |
| InChIKey | WOUMCBGGQRSPEO-NIUQKNMWSA-N |
| XLogP | 2.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |