C14H23NO4 — CID 166449021
tert-butyl N-[(3aS,4R,7aR)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]carbamate (PubChem CID 166449021) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is tert-butyl N-[(3aS,4R,7aR)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3aS,4R,7aR)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]carbamate |
|---|---|
| PubChem CID | 166449021 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | tert-butyl N-[(3aS,4R,7aR)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC=C[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H23NO4/c1-13(2,3)19-12(16)15-9-7-6-8-10-11(9)18-14(4,5)17-10/h6,8-11H,7H2,1-5H3,(H,15,16)/t9-,10-,11+/m1/s1 |
| InChIKey | KEPAEYPWXYAQEI-MXWKQRLJSA-N |
| XLogP | 2.36 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|