C36H55NO8Si2 — CID 166449056
[(3S,4R,5R,6R)-3-acetyloxy-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(phenylmethoxycarbonylamino)hept-1-en-4-yl] benzoate (PubChem CID 166449056) has the molecular formula C36H55NO8Si2 and a molecular weight of 686.01 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-3-acetyloxy-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(phenylmethoxycarbonylamino)hept-1-en-4-yl] benzoate.
| Compound Name | [(3S,4R,5R,6R)-3-acetyloxy-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(phenylmethoxycarbonylamino)hept-1-en-4-yl] benzoate |
|---|---|
| PubChem CID | 166449056 |
| Molecular Formula | C36H55NO8Si2 |
| Molecular Weight | 686.01 g/mol |
| Exact Mass | 685.35 |
| IUPAC Name | [(3S,4R,5R,6R)-3-acetyloxy-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(phenylmethoxycarbonylamino)hept-1-en-4-yl] benzoate |
| SMILES | C=C[C@H](OC(C)=O)[C@@H](OC(=O)c1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H55NO8Si2/c1-13-30(43-26(2)38)32(44-33(39)28-22-18-15-19-23-28)31(45-47(11,12)36(6,7)8)29(25-42-46(9,10)35(3,4)5)37-34(40)41-24-27-20-16-14-17-21-27/h13-23,29-32H,1,24-25H2,2-12H3,(H,37,40)/t29-,30+,31-,32-/m1/s1 |
| InChIKey | SVFWGCGAGNCVDW-VWPRMMSESA-N |
| XLogP | 8.04 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.01 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|