C29H37NO7Si — CID 166449059
[(1R,2S,5R,6R)-2-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxycarbonylamino)cyclohex-3-en-1-yl] benzoate (PubChem CID 166449059) has the molecular formula C29H37NO7Si and a molecular weight of 539.70 g/mol. Its IUPAC name is [(1R,2S,5R,6R)-2-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxycarbonylamino)cyclohex-3-en-1-yl] benzoate.
| Compound Name | [(1R,2S,5R,6R)-2-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxycarbonylamino)cyclohex-3-en-1-yl] benzoate |
|---|---|
| PubChem CID | 166449059 |
| Molecular Formula | C29H37NO7Si |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | [(1R,2S,5R,6R)-2-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxycarbonylamino)cyclohex-3-en-1-yl] benzoate |
| SMILES | CC(=O)OC1C=C[C@@H](NC(=O)OCc2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H37NO7Si/c1-20(31)35-24-18-17-23(30-28(33)34-19-21-13-9-7-10-14-21)25(37-38(5,6)29(2,3)4)26(24)36-27(32)22-15-11-8-12-16-22/h7-18,23-26H,19H2,1-6H3,(H,30,33)/t23-,24?,25-,26-/m1/s1 |
| InChIKey | DOKGHFWBWVLOMW-KLWMDXOYSA-N |
| XLogP | 5.40 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|