C20H28O6 — CID 166449099
(3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-(2-phenylethoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 166449099) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-(2-phenylethoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-(2-phenylethoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 166449099 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-(2-phenylethoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](OCCc1ccccc1)O[C@@H]2[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H28O6/c1-19(2)22-12-14(24-19)15-16-17(26-20(3,4)25-16)18(23-15)21-11-10-13-8-6-5-7-9-13/h5-9,14-18H,10-12H2,1-4H3/t14-,15+,16-,17-,18-/m0/s1 |
| InChIKey | SFMNRNFRCFTZKB-ADHGMGHFSA-N |
| XLogP | 2.64 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |