C21H36O6 — CID 166449101
(3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-[(Z)-non-4-enoxy]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 166449101) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is (3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-[(Z)-non-4-enoxy]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-[(Z)-non-4-enoxy]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 166449101 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-[(Z)-non-4-enoxy]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CCCC/C=C\CCCO[C@H]1O[C@H]([C@@H]2COC(C)(C)O2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C21H36O6/c1-6-7-8-9-10-11-12-13-22-19-18-17(26-21(4,5)27-18)16(24-19)15-14-23-20(2,3)25-15/h9-10,15-19H,6-8,11-14H2,1-5H3/b10-9-/t15-,16+,17-,18-,19-/m0/s1 |
| InChIKey | HHOHZAGSGHUSBF-FFQRLJMASA-N |
| XLogP | 3.93 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|