C22H21NO4 — CID 166449110
(7R)-1'-pentylspiro[6H-cyclopenta[f][1,3]benzodioxole-7,3'-indole]-2',5-dione (PubChem CID 166449110) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is (7R)-1'-pentylspiro[6H-cyclopenta[f][1,3]benzodioxole-7,3'-indole]-2',5-dione.
| Compound Name | (7R)-1'-pentylspiro[6H-cyclopenta[f][1,3]benzodioxole-7,3'-indole]-2',5-dione |
|---|---|
| PubChem CID | 166449110 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (7R)-1'-pentylspiro[6H-cyclopenta[f][1,3]benzodioxole-7,3'-indole]-2',5-dione |
| SMILES | CCCCCN1C(=O)[C@@]2(CC(=O)c3cc4c(cc32)OCO4)c2ccccc21 |
| InChI | InChI=1S/C22H21NO4/c1-2-3-6-9-23-17-8-5-4-7-15(17)22(21(23)25)12-18(24)14-10-19-20(11-16(14)22)27-13-26-19/h4-5,7-8,10-11H,2-3,6,9,12-13H2,1H3/t22-/m0/s1 |
| InChIKey | UGTQLKHEIQMVBY-QFIPXVFZSA-N |
| XLogP | 3.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|