C20H32N2O3Si — CID 166449194
N-[(3aR,4S,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]pyridin-2-amine (PubChem CID 166449194) has the molecular formula C20H32N2O3Si and a molecular weight of 376.57 g/mol. Its IUPAC name is N-[(3aR,4S,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]pyridin-2-amine.
| Compound Name | N-[(3aR,4S,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 166449194 |
| Molecular Formula | C20H32N2O3Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | N-[(3aR,4S,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]pyridin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1ccccn1)C=C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32N2O3Si/c1-19(2,3)26(6,7)25-15-12-11-14(22-16-10-8-9-13-21-16)17-18(15)24-20(4,5)23-17/h8-15,17-18H,1-7H3,(H,21,22)/t14-,15+,17+,18-/m0/s1 |
| InChIKey | HSUJWCZNLFBJTI-IDCNUPLLSA-N |
| XLogP | 4.34 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|