C9H12N3O3+ — CID 166449215
(3aR,4S,5S,7aS)-5-azido-2-methyl-2-methyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol (PubChem CID 166449215) has the molecular formula C9H12N3O3+ and a molecular weight of 210.21 g/mol. Its IUPAC name is (3aR,4S,5S,7aS)-5-azido-2-methyl-2-methyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aR,4S,5S,7aS)-5-azido-2-methyl-2-methyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 166449215 |
| Molecular Formula | C9H12N3O3+ |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (3aR,4S,5S,7aS)-5-azido-2-methyl-2-methyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
| SMILES | [CH2+]C1(C)O[C@@H]2[C@@H](O)[C@@H](N=[N+]=[N-])C=C[C@@H]2O1 |
| InChI | InChI=1S/C9H12N3O3/c1-9(2)14-6-4-3-5(11-12-10)7(13)8(6)15-9/h3-8,13H,1H2,2H3/q+1/t5-,6-,7-,8-,9?/m0/s1 |
| InChIKey | WRCNMKDFKZECLR-XSRSDNDWSA-N |
| XLogP | 0.93 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|