C15H28O4Si — CID 166449254
(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5R)-5-ethynyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 166449254) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5R)-5-ethynyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5R)-5-ethynyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 166449254 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5R)-5-ethynyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | C#C[C@H]1OC(C)(C)O[C@@H]1[C@@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O4Si/c1-9-11-13(18-15(5,6)17-11)12(10-16)19-20(7,8)14(2,3)4/h1,11-13,16H,10H2,2-8H3/t11-,12-,13+/m1/s1 |
| InChIKey | RLYRFCIEWDYKTE-UPJWGTAASA-N |
| XLogP | 2.52 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|