C23H45BO7Si — CID 166449255
tert-butyl-[(1S)-1-[(4S,5R)-2,2-dimethyl-5-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-dioxolan-4-yl]-2,2-dimethoxyethoxy]-dimethylsilane (PubChem CID 166449255) has the molecular formula C23H45BO7Si and a molecular weight of 472.50 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(4S,5R)-2,2-dimethyl-5-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-dioxolan-4-yl]-2,2-dimethoxyethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S)-1-[(4S,5R)-2,2-dimethyl-5-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-dioxolan-4-yl]-2,2-dimethoxyethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 166449255 |
| Molecular Formula | C23H45BO7Si |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | tert-butyl-[(1S)-1-[(4S,5R)-2,2-dimethyl-5-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-dioxolan-4-yl]-2,2-dimethoxyethoxy]-dimethylsilane |
| SMILES | COC(OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1/C=C\B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H45BO7Si/c1-20(2,3)32(12,13)29-18(19(25-10)26-11)17-16(27-23(8,9)28-17)14-15-24-30-21(4,5)22(6,7)31-24/h14-19H,1-13H3/b15-14-/t16-,17+,18+/m1/s1 |
| InChIKey | PLNSYOZGSAFRHT-IAGXNYRLSA-N |
| XLogP | 4.70 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|