C17H35BO7Si — CID 166449256
[(Z)-2-[(4R,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]boronic acid (PubChem CID 166449256) has the molecular formula C17H35BO7Si and a molecular weight of 390.36 g/mol. Its IUPAC name is [(Z)-2-[(4R,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]boronic acid.
| Compound Name | [(Z)-2-[(4R,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]boronic acid |
|---|---|
| PubChem CID | 166449256 |
| Molecular Formula | C17H35BO7Si |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [(Z)-2-[(4R,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]boronic acid |
| SMILES | COC(OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1/C=C\B(O)O |
| InChI | InChI=1S/C17H35BO7Si/c1-16(2,3)26(8,9)25-14(15(21-6)22-7)13-12(10-11-18(19)20)23-17(4,5)24-13/h10-15,19-20H,1-9H3/b11-10-/t12-,13+,14+/m1/s1 |
| InChIKey | FDSDHGLORFFOFW-UIUZBERGSA-N |
| XLogP | 2.08 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|