C17H26O3 — CID 166449291
8,10-ditert-butyl-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one (PubChem CID 166449291) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 8,10-ditert-butyl-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one.
| Compound Name | 8,10-ditert-butyl-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one |
|---|---|
| PubChem CID | 166449291 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 8,10-ditert-butyl-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one |
| SMILES | CC(C)(C)C1=CC2(C=C(C(C)(C)C)C1=O)OCCCO2 |
| InChI | InChI=1S/C17H26O3/c1-15(2,3)12-10-17(19-8-7-9-20-17)11-13(14(12)18)16(4,5)6/h10-11H,7-9H2,1-6H3 |
| InChIKey | OSKPTTPPFFABBM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |