C9H16O6S — CID 166449622
(2R,3S,4R,5R)-2-(2-methylprop-2-enylsulfonyl)oxane-3,4,5-triol (PubChem CID 166449622) has the molecular formula C9H16O6S and a molecular weight of 252.29 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(2-methylprop-2-enylsulfonyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R)-2-(2-methylprop-2-enylsulfonyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 166449622 |
| Molecular Formula | C9H16O6S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (2R,3S,4R,5R)-2-(2-methylprop-2-enylsulfonyl)oxane-3,4,5-triol |
| SMILES | C=C(C)CS(=O)(=O)[C@H]1OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H16O6S/c1-5(2)4-16(13,14)9-8(12)7(11)6(10)3-15-9/h6-12H,1,3-4H2,2H3/t6-,7-,8+,9-/m1/s1 |
| InChIKey | WUBVBJSLVNAMPR-LURQLKTLSA-N |
| XLogP | -1.58 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|