C10H18O7S — CID 166449643
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-methylprop-2-enylsulfonyl)oxane-3,4,5-triol (PubChem CID 166449643) has the molecular formula C10H18O7S and a molecular weight of 282.31 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-methylprop-2-enylsulfonyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-methylprop-2-enylsulfonyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 166449643 |
| Molecular Formula | C10H18O7S |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-methylprop-2-enylsulfonyl)oxane-3,4,5-triol |
| SMILES | C=C(C)CS(=O)(=O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O7S/c1-5(2)4-18(15,16)10-9(14)8(13)7(12)6(3-11)17-10/h6-14H,1,3-4H2,2H3/t6-,7-,8+,9-,10+/m1/s1 |
| InChIKey | WUNNXSXPXOGFMA-SPFKKGSWSA-N |
| XLogP | -2.22 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|