C22H21NO5 — CID 166449656
(4aR,6S,7R,8R,8aS)-2-phenyl-6-quinolin-6-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 166449656) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aS)-2-phenyl-6-quinolin-6-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6S,7R,8R,8aS)-2-phenyl-6-quinolin-6-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 166449656 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (4aR,6S,7R,8R,8aS)-2-phenyl-6-quinolin-6-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](c2ccc3ncccc3c2)O[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C22H21NO5/c24-18-19(25)21-17(12-26-22(28-21)13-5-2-1-3-6-13)27-20(18)15-8-9-16-14(11-15)7-4-10-23-16/h1-11,17-22,24-25H,12H2/t17-,18-,19-,20+,21-,22?/m1/s1 |
| InChIKey | PHISRDJFWGFKKO-VAIYXKLGSA-N |
| XLogP | 2.51 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |