C17H19NO4S — CID 166449666
methyl (2S)-2-amino-3-[4-(3-methylsulfonylphenyl)phenyl]propanoate (PubChem CID 166449666) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[4-(3-methylsulfonylphenyl)phenyl]propanoate.
| Compound Name | methyl (2S)-2-amino-3-[4-(3-methylsulfonylphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 166449666 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | methyl (2S)-2-amino-3-[4-(3-methylsulfonylphenyl)phenyl]propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(-c2cccc(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-22-17(19)16(18)10-12-6-8-13(9-7-12)14-4-3-5-15(11-14)23(2,20)21/h3-9,11,16H,10,18H2,1-2H3/t16-/m0/s1 |
| InChIKey | CULVHQPGPSVMOX-INIZCTEOSA-N |
| XLogP | 1.80 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |