C20H24O3 — CID 166450114
ethyl 3-[4-hydroxy-3-(3-propylphenyl)phenyl]propanoate (PubChem CID 166450114) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is ethyl 3-[4-hydroxy-3-(3-propylphenyl)phenyl]propanoate.
| Compound Name | ethyl 3-[4-hydroxy-3-(3-propylphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 166450114 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | ethyl 3-[4-hydroxy-3-(3-propylphenyl)phenyl]propanoate |
| SMILES | CCCc1cccc(-c2cc(CCC(=O)OCC)ccc2O)c1 |
| InChI | InChI=1S/C20H24O3/c1-3-6-15-7-5-8-17(13-15)18-14-16(9-11-19(18)21)10-12-20(22)23-4-2/h5,7-9,11,13-14,21H,3-4,6,10,12H2,1-2H3 |
| InChIKey | JIYIAUFTJWWJIP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |