C29H27N3O6 — CID 166450393
(E)-3-(1,3-benzodioxol-5-yl)-1-[8,9-dimethoxy-1-(4-methoxyphenyl)-6,10b-dihydro-5H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl]prop-2-en-1-one (PubChem CID 166450393) has the molecular formula C29H27N3O6 and a molecular weight of 513.55 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-[8,9-dimethoxy-1-(4-methoxyphenyl)-6,10b-dihydro-5H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[8,9-dimethoxy-1-(4-methoxyphenyl)-6,10b-dihydro-5H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166450393 |
| Molecular Formula | C29H27N3O6 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[8,9-dimethoxy-1-(4-methoxyphenyl)-6,10b-dihydro-5H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl]prop-2-en-1-one |
| SMILES | COc1ccc(N2N=C(C(=O)/C=C/c3ccc4c(c3)OCO4)N3CCc4cc(OC)c(OC)cc4C32)cc1 |
| InChI | InChI=1S/C29H27N3O6/c1-34-21-8-6-20(7-9-21)32-29-22-16-26(36-3)25(35-2)15-19(22)12-13-31(29)28(30-32)23(33)10-4-18-5-11-24-27(14-18)38-17-37-24/h4-11,14-16,29H,12-13,17H2,1-3H3/b10-4+ |
| InChIKey | SRXUQULXQOHXCK-ONNFQVAWSA-N |
| XLogP | 4.41 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|