About pyrrolo[1,2-a]imidazol-3-one
pyrrolo[1,2-a]imidazol-3-one (PubChem CID 166450450) has the molecular formula C6H4N2O
and a molecular weight of 120.11 g/mol. Its IUPAC name is pyrrolo[1,2-a]imidazol-3-one.
Molecular Properties
| Compound Name | pyrrolo[1,2-a]imidazol-3-one |
| PubChem CID | 166450450 |
| Molecular Formula | C6H4N2O |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.03 |
| IUPAC Name | pyrrolo[1,2-a]imidazol-3-one |
| SMILES | O=C1C=Nc2cccn21 |
| InChI | InChI=1S/C6H4N2O/c9-6-4-7-5-2-1-3-8(5)6/h1-4H |
| InChIKey | XNSRHCFAIDAKGW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolo[1,2-a]imidazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[1,2-a]imidazol-3-one?
The IUPAC name of pyrrolo[1,2-a]imidazol-3-one (CID 166450450) is pyrrolo[1,2-a]imidazol-3-one.
What is the SMILES notation for pyrrolo[1,2-a]imidazol-3-one?
The canonical SMILES for pyrrolo[1,2-a]imidazol-3-one is O=C1C=Nc2cccn21.
What is the InChIKey of pyrrolo[1,2-a]imidazol-3-one?
The InChIKey is XNSRHCFAIDAKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O/c9-6-4-7-5-2-1-3-8(5)6/h1-4H.
What are the key properties of pyrrolo[1,2-a]imidazol-3-one?
pyrrolo[1,2-a]imidazol-3-one has a molecular weight of 120.11 g/mol, XLogP of 0.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[1,2-a]imidazol-3-one is sourced from PubChem (CID 166450450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).