C25H20ClF3N4O4 — CID 166450629
2-amino-4-(4-chloro-3-nitrophenyl)-7,7-dimethyl-5-oxo-1-[4-(trifluoromethoxy)phenyl]-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 166450629) has the molecular formula C25H20ClF3N4O4 and a molecular weight of 532.91 g/mol. Its IUPAC name is 2-amino-4-(4-chloro-3-nitrophenyl)-7,7-dimethyl-5-oxo-1-[4-(trifluoromethoxy)phenyl]-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | 2-amino-4-(4-chloro-3-nitrophenyl)-7,7-dimethyl-5-oxo-1-[4-(trifluoromethoxy)phenyl]-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 166450629 |
| Molecular Formula | C25H20ClF3N4O4 |
| Molecular Weight | 532.91 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 2-amino-4-(4-chloro-3-nitrophenyl)-7,7-dimethyl-5-oxo-1-[4-(trifluoromethoxy)phenyl]-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccc(OC(F)(F)F)cc1)C(N)=C(C#N)C2c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H20ClF3N4O4/c1-24(2)10-19-22(20(34)11-24)21(13-3-8-17(26)18(9-13)33(35)36)16(12-30)23(31)32(19)14-4-6-15(7-5-14)37-25(27,28)29/h3-9,21H,10-11,31H2,1-2H3 |
| InChIKey | WTFFUJZEAJQUMS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.91 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|