About bis(trifluoromethylsulfonyl)azanide;tripropylazanium
bis(trifluoromethylsulfonyl)azanide;tripropylazanium (PubChem CID 166451231) has the molecular formula C11H22F6N2O4S2
and a molecular weight of 424.43 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;tripropylazanium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;tripropylazanium |
| PubChem CID | 166451231 |
| Molecular Formula | C11H22F6N2O4S2 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;tripropylazanium |
| SMILES | CCC[NH+](CCC)CCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H21N.C2F6NO4S2/c1-4-7-10(8-5-2)9-6-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-9H2,1-3H3;/q;-1/p+1 |
| InChIKey | XVRXPHYHLWPFEP-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(trifluoromethylsulfonyl)azanide;tripropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;tripropylazanium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;tripropylazanium (CID 166451231) is bis(trifluoromethylsulfonyl)azanide;tripropylazanium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;tripropylazanium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;tripropylazanium is CCC[NH+](CCC)CCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;tripropylazanium?
The InChIKey is XVRXPHYHLWPFEP-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H21N.C2F6NO4S2/c1-4-7-10(8-5-2)9-6-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-9H2,1-3H3;/q;-1/p+1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;tripropylazanium?
bis(trifluoromethylsulfonyl)azanide;tripropylazanium has a molecular weight of 424.43 g/mol, XLogP of 2.16, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;tripropylazanium is sourced from PubChem (CID 166451231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).