C35H47N5O3Si — CID 166451371
tert-butyl N-[1-[8-cyclopentyl-7-oxo-5-(2-trimethylsilylethynyl)pyrido[2,3-d]pyrimidin-2-yl]piperidin-4-yl]-N-(2-phenylethyl)carbamate (PubChem CID 166451371) has the molecular formula C35H47N5O3Si and a molecular weight of 613.88 g/mol. Its IUPAC name is tert-butyl N-[1-[8-cyclopentyl-7-oxo-5-(2-trimethylsilylethynyl)pyrido[2,3-d]pyrimidin-2-yl]piperidin-4-yl]-N-(2-phenylethyl)carbamate.
| Compound Name | tert-butyl N-[1-[8-cyclopentyl-7-oxo-5-(2-trimethylsilylethynyl)pyrido[2,3-d]pyrimidin-2-yl]piperidin-4-yl]-N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 166451371 |
| Molecular Formula | C35H47N5O3Si |
| Molecular Weight | 613.88 g/mol |
| Exact Mass | 613.34 |
| IUPAC Name | tert-butyl N-[1-[8-cyclopentyl-7-oxo-5-(2-trimethylsilylethynyl)pyrido[2,3-d]pyrimidin-2-yl]piperidin-4-yl]-N-(2-phenylethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1ccccc1)C1CCN(c2ncc3c(C#C[Si](C)(C)C)cc(=O)n(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C35H47N5O3Si/c1-35(2,3)43-34(42)39(22-16-26-12-8-7-9-13-26)28-17-20-38(21-18-28)33-36-25-30-27(19-23-44(4,5)6)24-31(41)40(32(30)37-33)29-14-10-11-15-29/h7-9,12-13,24-25,28-29H,10-11,14-18,20-22H2,1-6H3 |
| InChIKey | JEIGAIIATWITHR-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.88 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|