C14H14N6O2 — CID 166451557
3-[(E)-[(1,3-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazinylidene]methyl]benzene-1,2-diol (PubChem CID 166451557) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is 3-[(E)-[(1,3-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazinylidene]methyl]benzene-1,2-diol.
| Compound Name | 3-[(E)-[(1,3-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazinylidene]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 166451557 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-[(E)-[(1,3-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazinylidene]methyl]benzene-1,2-diol |
| SMILES | Cc1nn(C)c2ncnc(N/N=C/c3cccc(O)c3O)c12 |
| InChI | InChI=1S/C14H14N6O2/c1-8-11-13(15-7-16-14(11)20(2)19-8)18-17-6-9-4-3-5-10(21)12(9)22/h3-7,21-22H,1-2H3,(H,15,16,18)/b17-6+ |
| InChIKey | QMIHUBPIKXGFSP-UBKPWBPPSA-N |
| XLogP | 1.53 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|