C20H27O3- — CID 166451872
(4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-4,6,8-trienoate (PubChem CID 166451872) has the molecular formula C20H27O3- and a molecular weight of 315.43 g/mol. Its IUPAC name is (4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-4,6,8-trienoate.
| Compound Name | (4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-4,6,8-trienoate |
|---|---|
| PubChem CID | 166451872 |
| Molecular Formula | C20H27O3- |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | (4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-4,6,8-trienoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)CC(=O)[O-])C(C)(C)CCC1=O |
| InChI | InChI=1S/C20H28O3/c1-14(7-6-8-15(2)13-19(22)23)9-10-17-16(3)18(21)11-12-20(17,4)5/h6-10,15H,11-13H2,1-5H3,(H,22,23)/p-1/b8-6+,10-9+,14-7+ |
| InChIKey | XMIWQNUYRMSNDU-KEUMZJLDSA-M |
| XLogP | 3.53 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|