About (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate
(9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate (PubChem CID 166451896) has the molecular formula C18H31O4-
and a molecular weight of 311.44 g/mol. Its IUPAC name is (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate.
Molecular Properties
| Compound Name | (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate |
| PubChem CID | 166451896 |
| Molecular Formula | C18H31O4- |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate |
| SMILES | CCCCC/C=C\[C@H]1O[C@@H]1[C@@H](O)CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H32O4/c1-2-3-4-6-10-13-16-18(22-16)15(19)12-9-7-5-8-11-14-17(20)21/h10,13,15-16,18-19H,2-9,11-12,14H2,1H3,(H,20,21)/p-1/b13-10-/t15-,16+,18+/m0/s1 |
| InChIKey | NFFSPFJIYOTZQX-OVXXOIRXSA-M |
| XLogP | 2.73 |
| TPSA | 72.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate?
The IUPAC name of (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate (CID 166451896) is (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate.
What is the SMILES notation for (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate?
The canonical SMILES for (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate is CCCCC/C=C\[C@H]1O[C@@H]1[C@@H](O)CCCCCCCC(=O)[O-].
What is the InChIKey of (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate?
The InChIKey is NFFSPFJIYOTZQX-OVXXOIRXSA-M. The full InChI is InChI=1S/C18H32O4/c1-2-3-4-6-10-13-16-18(22-16)15(19)12-9-7-5-8-11-14-17(20)21/h10,13,15-16,18-19H,2-9,11-12,14H2,1H3,(H,20,21)/p-1/b13-10-/t15-,16+,18+/m0/s1.
What are the key properties of (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate?
(9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate has a molecular weight of 311.44 g/mol, XLogP of 2.73, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9S)-9-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]-9-hydroxynonanoate is sourced from PubChem (CID 166451896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).