C23H19FN4O2 — CID 166452402
2-[6-(2,5-dihydropyrrol-1-yl)-2-pyridinyl]-4-(2-fluoro-6-methoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one (PubChem CID 166452402) has the molecular formula C23H19FN4O2 and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-[6-(2,5-dihydropyrrol-1-yl)-2-pyridinyl]-4-(2-fluoro-6-methoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one.
| Compound Name | 2-[6-(2,5-dihydropyrrol-1-yl)-2-pyridinyl]-4-(2-fluoro-6-methoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 166452402 |
| Molecular Formula | C23H19FN4O2 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-[6-(2,5-dihydropyrrol-1-yl)-2-pyridinyl]-4-(2-fluoro-6-methoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one |
| SMILES | COc1cccc(F)c1-c1nccc2c1CN(c1cccc(N3CC=CC3)n1)C2=O |
| InChI | InChI=1S/C23H19FN4O2/c1-30-18-7-4-6-17(24)21(18)22-16-14-28(23(29)15(16)10-11-25-22)20-9-5-8-19(26-20)27-12-2-3-13-27/h2-11H,12-14H2,1H3 |
| InChIKey | RBZBNFPQBIWUAQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|