C19H16N2O5 — CID 16645384
[2-(4-nitrophenyl)-2-oxoethyl] 3-(1H-indol-3-yl)propanoate (PubChem CID 16645384) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 3-(1H-indol-3-yl)propanoate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 16645384 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 3-(1H-indol-3-yl)propanoate |
| SMILES | O=C(CCc1c[nH]c2ccccc12)OCC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16N2O5/c22-18(13-5-8-15(9-6-13)21(24)25)12-26-19(23)10-7-14-11-20-17-4-2-1-3-16(14)17/h1-6,8-9,11,20H,7,10,12H2 |
| InChIKey | PZLQLHPCCVIJRX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|