About (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate
(2-oxo-1,2-diphenylethyl) 3-fluorobenzoate (PubChem CID 16645457) has the molecular formula C21H15FO3
and a molecular weight of 334.35 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate.
Molecular Properties
| Compound Name | (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate |
| PubChem CID | 16645457 |
| Molecular Formula | C21H15FO3 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate |
| SMILES | O=C(OC(C(=O)c1ccccc1)c1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C21H15FO3/c22-18-13-7-12-17(14-18)21(24)25-20(16-10-5-2-6-11-16)19(23)15-8-3-1-4-9-15/h1-14,20H |
| InChIKey | DITLWGIWYDXJSZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate?
The IUPAC name of (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate (CID 16645457) is (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate.
What is the SMILES notation for (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate?
The canonical SMILES for (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate is O=C(OC(C(=O)c1ccccc1)c1ccccc1)c1cccc(F)c1.
What is the InChIKey of (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate?
The InChIKey is DITLWGIWYDXJSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15FO3/c22-18-13-7-12-17(14-18)21(24)25-20(16-10-5-2-6-11-16)19(23)15-8-3-1-4-9-15/h1-14,20H.
What are the key properties of (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate?
(2-oxo-1,2-diphenylethyl) 3-fluorobenzoate has a molecular weight of 334.35 g/mol, XLogP of 4.61, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,2-diphenylethyl) 3-fluorobenzoate is sourced from PubChem (CID 16645457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).