C23H33N3O2 — CID 166454995
N-[(1R,2R,9R)-4,12-dimethyl-1-tetracyclo[7.3.1.02,7.06,11]tridecanyl]-2-[3-(methylamino)-2-oxo-1-pyridinyl]acetamide (PubChem CID 166454995) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-[(1R,2R,9R)-4,12-dimethyl-1-tetracyclo[7.3.1.02,7.06,11]tridecanyl]-2-[3-(methylamino)-2-oxo-1-pyridinyl]acetamide.
| Compound Name | N-[(1R,2R,9R)-4,12-dimethyl-1-tetracyclo[7.3.1.02,7.06,11]tridecanyl]-2-[3-(methylamino)-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 166454995 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-[(1R,2R,9R)-4,12-dimethyl-1-tetracyclo[7.3.1.02,7.06,11]tridecanyl]-2-[3-(methylamino)-2-oxo-1-pyridinyl]acetamide |
| SMILES | CNc1cccn(CC(=O)N[C@@]23C[C@@H]4CC(C5CC(C)C[C@@H]2C5C4)C3C)c1=O |
| InChI | InChI=1S/C23H33N3O2/c1-13-7-17-16-9-15-10-18(17)19(8-13)23(11-15,14(16)2)25-21(27)12-26-6-4-5-20(24-3)22(26)28/h4-6,13-19,24H,7-12H2,1-3H3,(H,25,27)/t13?,14?,15-,16?,17?,18?,19-,23-/m1/s1 |
| InChIKey | RPOQDWFSCGUVKL-LAIDZJPTSA-N |
| XLogP | 3.10 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |