C18H21N5O5S — CID 166455192
methyl (E)-7-[(1-ethyl-2-oxo-3-pyridinyl)amino]-7-oxo-6-(1,3,4-thiadiazole-2-carbonylamino)hept-2-enoate (PubChem CID 166455192) has the molecular formula C18H21N5O5S and a molecular weight of 419.46 g/mol. Its IUPAC name is methyl (E)-7-[(1-ethyl-2-oxo-3-pyridinyl)amino]-7-oxo-6-(1,3,4-thiadiazole-2-carbonylamino)hept-2-enoate.
| Compound Name | methyl (E)-7-[(1-ethyl-2-oxo-3-pyridinyl)amino]-7-oxo-6-(1,3,4-thiadiazole-2-carbonylamino)hept-2-enoate |
|---|---|
| PubChem CID | 166455192 |
| Molecular Formula | C18H21N5O5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | methyl (E)-7-[(1-ethyl-2-oxo-3-pyridinyl)amino]-7-oxo-6-(1,3,4-thiadiazole-2-carbonylamino)hept-2-enoate |
| SMILES | CCn1cccc(NC(=O)C(CC/C=C/C(=O)OC)NC(=O)c2nncs2)c1=O |
| InChI | InChI=1S/C18H21N5O5S/c1-3-23-10-6-8-13(18(23)27)21-15(25)12(7-4-5-9-14(24)28-2)20-16(26)17-22-19-11-29-17/h5-6,8-12H,3-4,7H2,1-2H3,(H,20,26)(H,21,25)/b9-5+ |
| InChIKey | QQKYUVKXOMMDIO-WEVVVXLNSA-N |
| XLogP | 0.97 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|