C30H43N5O6 — CID 166455194
methyl (E,6S)-7-[[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-6-[4-(methylamino)butanoylamino]-7-oxohept-2-enoate (PubChem CID 166455194) has the molecular formula C30H43N5O6 and a molecular weight of 569.70 g/mol. Its IUPAC name is methyl (E,6S)-7-[[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-6-[4-(methylamino)butanoylamino]-7-oxohept-2-enoate.
| Compound Name | methyl (E,6S)-7-[[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-6-[4-(methylamino)butanoylamino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 166455194 |
| Molecular Formula | C30H43N5O6 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.32 |
| IUPAC Name | methyl (E,6S)-7-[[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-6-[4-(methylamino)butanoylamino]-7-oxohept-2-enoate |
| SMILES | CNCCCC(=O)N[C@@H](CC/C=C/C(=O)OC)C(=O)Nc1cccn(CC(=O)NC2C3CC4CC(C3)CC2C4)c1=O |
| InChI | InChI=1S/C30H43N5O6/c1-31-11-5-9-25(36)32-23(7-3-4-10-27(38)41-2)29(39)33-24-8-6-12-35(30(24)40)18-26(37)34-28-21-14-19-13-20(16-21)17-22(28)15-19/h4,6,8,10,12,19-23,28,31H,3,5,7,9,11,13-18H2,1-2H3,(H,32,36)(H,33,39)(H,34,37)/b10-4+/t19?,20?,21?,22?,23-,28?/m0/s1 |
| InChIKey | UVDULECXPQMFNX-KHMVZKIQSA-N |
| XLogP | 1.72 |
| TPSA | 147.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|