C32H48N8O6 — CID 166455468
N-[1-[2-[[1-(aminomethyl)-3-butyl-5-methylcyclohexyl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-2-[(1-methylimidazole-4-carbonyl)amino]-5-oxohexanediamide (PubChem CID 166455468) has the molecular formula C32H48N8O6 and a molecular weight of 640.79 g/mol. Its IUPAC name is N-[1-[2-[[1-(aminomethyl)-3-butyl-5-methylcyclohexyl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-2-[(1-methylimidazole-4-carbonyl)amino]-5-oxohexanediamide.
| Compound Name | N-[1-[2-[[1-(aminomethyl)-3-butyl-5-methylcyclohexyl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-2-[(1-methylimidazole-4-carbonyl)amino]-5-oxohexanediamide |
|---|---|
| PubChem CID | 166455468 |
| Molecular Formula | C32H48N8O6 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.37 |
| IUPAC Name | N-[1-[2-[[1-(aminomethyl)-3-butyl-5-methylcyclohexyl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-2-[(1-methylimidazole-4-carbonyl)amino]-5-oxohexanediamide |
| SMILES | CCCCC1CC(C)CC(CN)(NC(=O)Cn2cccc(NC(=O)C(CCC(=O)C(=O)NCC)NC(=O)c3cn(C)cn3)c2=O)C1 |
| InChI | InChI=1S/C32H48N8O6/c1-5-7-9-22-14-21(3)15-32(16-22,19-33)38-27(42)18-40-13-8-10-24(31(40)46)37-28(43)23(11-12-26(41)30(45)34-6-2)36-29(44)25-17-39(4)20-35-25/h8,10,13,17,20-23H,5-7,9,11-12,14-16,18-19,33H2,1-4H3,(H,34,45)(H,36,44)(H,37,43)(H,38,42) |
| InChIKey | JVFDBRMPVCFNLL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 199.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|