C32H40N6O5 — CID 166455600
(2S)-N-[1-[3-(1-adamantyl)propyl]-2-oxo-3-pyridinyl]-2-[(4-cyano-1-methylpyrrole-2-carbonyl)amino]-N'-methyl-5-oxohexanediamide (PubChem CID 166455600) has the molecular formula C32H40N6O5 and a molecular weight of 588.71 g/mol. Its IUPAC name is (2S)-N-[1-[3-(1-adamantyl)propyl]-2-oxo-3-pyridinyl]-2-[(4-cyano-1-methylpyrrole-2-carbonyl)amino]-N'-methyl-5-oxohexanediamide.
| Compound Name | (2S)-N-[1-[3-(1-adamantyl)propyl]-2-oxo-3-pyridinyl]-2-[(4-cyano-1-methylpyrrole-2-carbonyl)amino]-N'-methyl-5-oxohexanediamide |
|---|---|
| PubChem CID | 166455600 |
| Molecular Formula | C32H40N6O5 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | (2S)-N-[1-[3-(1-adamantyl)propyl]-2-oxo-3-pyridinyl]-2-[(4-cyano-1-methylpyrrole-2-carbonyl)amino]-N'-methyl-5-oxohexanediamide |
| SMILES | CNC(=O)C(=O)CC[C@H](NC(=O)c1cc(C#N)cn1C)C(=O)Nc1cccn(CCCC23CC4CC(CC(C4)C2)C3)c1=O |
| InChI | InChI=1S/C32H40N6O5/c1-34-30(42)27(39)7-6-24(35-29(41)26-14-23(18-33)19-37(26)2)28(40)36-25-5-3-9-38(31(25)43)10-4-8-32-15-20-11-21(16-32)13-22(12-20)17-32/h3,5,9,14,19-22,24H,4,6-8,10-13,15-17H2,1-2H3,(H,34,42)(H,35,41)(H,36,40)/t20?,21?,22?,24-,32?/m0/s1 |
| InChIKey | OCRHAMCOKZTRHP-CRTAWCPZSA-N |
| XLogP | 2.89 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|