N-(2-methoxyethyl)-N-propylsulfamoyl fluoride

C6H14FNO3S — CID 166456350

IUPACN-(2-methoxyethyl)-N-propylsulfamoyl fluoride
SMILESCCCN(CCOC)S(=O)(=O)F
InChIInChI=1S/C6H14FNO3S/c1-3-4-8(5-6-11-2)12(7,9)10/h3-6H2,1-2H3
InChIKeySNLHGLSBKCAAJH-UHFFFAOYSA-N
MW199.25 g/mol
LogP0.56
Rot. Bonds6

About N-(2-methoxyethyl)-N-propylsulfamoyl fluoride

N-(2-methoxyethyl)-N-propylsulfamoyl fluoride (PubChem CID 166456350) has the molecular formula C6H14FNO3S and a molecular weight of 199.25 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-propylsulfamoyl fluoride.

Molecular Properties

Compound NameN-(2-methoxyethyl)-N-propylsulfamoyl fluoride
PubChem CID166456350
Molecular FormulaC6H14FNO3S
Molecular Weight199.25 g/mol
Exact Mass199.07
IUPAC NameN-(2-methoxyethyl)-N-propylsulfamoyl fluoride
SMILESCCCN(CCOC)S(=O)(=O)F
InChIInChI=1S/C6H14FNO3S/c1-3-4-8(5-6-11-2)12(7,9)10/h3-6H2,1-2H3
InChIKeySNLHGLSBKCAAJH-UHFFFAOYSA-N
XLogP0.56
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.25
LogP ≤ 50.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze N-(2-methoxyethyl)-N-propylsulfamoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2-methoxyethyl)-N-propylsulfamoyl fluoride?
The IUPAC name of N-(2-methoxyethyl)-N-propylsulfamoyl fluoride (CID 166456350) is N-(2-methoxyethyl)-N-propylsulfamoyl fluoride.
What is the SMILES notation for N-(2-methoxyethyl)-N-propylsulfamoyl fluoride?
The canonical SMILES for N-(2-methoxyethyl)-N-propylsulfamoyl fluoride is CCCN(CCOC)S(=O)(=O)F.
What is the InChIKey of N-(2-methoxyethyl)-N-propylsulfamoyl fluoride?
The InChIKey is SNLHGLSBKCAAJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14FNO3S/c1-3-4-8(5-6-11-2)12(7,9)10/h3-6H2,1-2H3.
What are the key properties of N-(2-methoxyethyl)-N-propylsulfamoyl fluoride?
N-(2-methoxyethyl)-N-propylsulfamoyl fluoride has a molecular weight of 199.25 g/mol, XLogP of 0.56, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-N-propylsulfamoyl fluoride is sourced from PubChem (CID 166456350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).