C25H27F3N4O3 — CID 166456528
5-[1-(8-methoxyquinolin-2-yl)piperidin-4-yl]-3-[(2E,4E)-5-(trifluoromethoxy)hepta-2,4-dien-3-yl]-1,2,4-oxadiazole (PubChem CID 166456528) has the molecular formula C25H27F3N4O3 and a molecular weight of 488.51 g/mol. Its IUPAC name is 5-[1-(8-methoxyquinolin-2-yl)piperidin-4-yl]-3-[(2E,4E)-5-(trifluoromethoxy)hepta-2,4-dien-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-[1-(8-methoxyquinolin-2-yl)piperidin-4-yl]-3-[(2E,4E)-5-(trifluoromethoxy)hepta-2,4-dien-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 166456528 |
| Molecular Formula | C25H27F3N4O3 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 5-[1-(8-methoxyquinolin-2-yl)piperidin-4-yl]-3-[(2E,4E)-5-(trifluoromethoxy)hepta-2,4-dien-3-yl]-1,2,4-oxadiazole |
| SMILES | C/C=C(\C=C(/CC)OC(F)(F)F)c1noc(C2CCN(c3ccc4cccc(OC)c4n3)CC2)n1 |
| InChI | InChI=1S/C25H27F3N4O3/c1-4-16(15-19(5-2)34-25(26,27)28)23-30-24(35-31-23)18-11-13-32(14-12-18)21-10-9-17-7-6-8-20(33-3)22(17)29-21/h4,6-10,15,18H,5,11-14H2,1-3H3/b16-4+,19-15+ |
| InChIKey | XVHQXHZVRFPABE-JNDCMMIHSA-N |
| XLogP | 6.24 |
| TPSA | 73.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|