C18H19ClF4N6OS — CID 166456630
2-[4-[(Z)-N'-[amino(difluoromethyl)amino]carbamimidoyl]phenyl]-N-(5-chloro-1,3-thiazol-2-yl)-2-(3,3-difluorocyclopentyl)acetamide (PubChem CID 166456630) has the molecular formula C18H19ClF4N6OS and a molecular weight of 478.90 g/mol. Its IUPAC name is 2-[4-[(Z)-N'-[amino(difluoromethyl)amino]carbamimidoyl]phenyl]-N-(5-chloro-1,3-thiazol-2-yl)-2-(3,3-difluorocyclopentyl)acetamide.
| Compound Name | 2-[4-[(Z)-N'-[amino(difluoromethyl)amino]carbamimidoyl]phenyl]-N-(5-chloro-1,3-thiazol-2-yl)-2-(3,3-difluorocyclopentyl)acetamide |
|---|---|
| PubChem CID | 166456630 |
| Molecular Formula | C18H19ClF4N6OS |
| Molecular Weight | 478.90 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-[4-[(Z)-N'-[amino(difluoromethyl)amino]carbamimidoyl]phenyl]-N-(5-chloro-1,3-thiazol-2-yl)-2-(3,3-difluorocyclopentyl)acetamide |
| SMILES | N/C(=N\N(N)C(F)F)c1ccc(C(C(=O)Nc2ncc(Cl)s2)C2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C18H19ClF4N6OS/c19-12-8-26-17(31-12)27-15(30)13(11-5-6-18(22,23)7-11)9-1-3-10(4-2-9)14(24)28-29(25)16(20)21/h1-4,8,11,13,16H,5-7,25H2,(H2,24,28)(H,26,27,30) |
| InChIKey | ZQOAAWREQMUYFO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|