About methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate
methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate (PubChem CID 166456786) has the molecular formula C15H16F2N4O2
and a molecular weight of 322.32 g/mol. Its IUPAC name is methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate |
| PubChem CID | 166456786 |
| Molecular Formula | C15H16F2N4O2 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate |
| SMILES | COC(=O)C(c1ccc(-c2nn[nH]n2)cc1)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C15H16F2N4O2/c1-23-14(22)12(11-6-7-15(16,17)8-11)9-2-4-10(5-3-9)13-18-20-21-19-13/h2-5,11-12H,6-8H2,1H3,(H,18,19,20,21) |
| InChIKey | JQFQSWOSVPDYCU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate?
The IUPAC name of methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate (CID 166456786) is methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate.
What is the SMILES notation for methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate?
The canonical SMILES for methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate is COC(=O)C(c1ccc(-c2nn[nH]n2)cc1)C1CCC(F)(F)C1.
What is the InChIKey of methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate?
The InChIKey is JQFQSWOSVPDYCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2N4O2/c1-23-14(22)12(11-6-7-15(16,17)8-11)9-2-4-10(5-3-9)13-18-20-21-19-13/h2-5,11-12H,6-8H2,1H3,(H,18,19,20,21).
What are the key properties of methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate?
methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate has a molecular weight of 322.32 g/mol, XLogP of 2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,3-difluorocyclopentyl)-2-[4-(2H-tetrazol-5-yl)phenyl]acetate is sourced from PubChem (CID 166456786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).