About 2-propan-2-yloxy-1,3-benzoxazol-4-ol
2-propan-2-yloxy-1,3-benzoxazol-4-ol (PubChem CID 166456971) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is 2-propan-2-yloxy-1,3-benzoxazol-4-ol.
Molecular Properties
| Compound Name | 2-propan-2-yloxy-1,3-benzoxazol-4-ol |
| PubChem CID | 166456971 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-propan-2-yloxy-1,3-benzoxazol-4-ol |
| SMILES | CC(C)Oc1nc2c(O)cccc2o1 |
| InChI | InChI=1S/C10H11NO3/c1-6(2)13-10-11-9-7(12)4-3-5-8(9)14-10/h3-6,12H,1-2H3 |
| InChIKey | WWLNKFBOFGZBSY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propan-2-yloxy-1,3-benzoxazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxy-1,3-benzoxazol-4-ol?
The IUPAC name of 2-propan-2-yloxy-1,3-benzoxazol-4-ol (CID 166456971) is 2-propan-2-yloxy-1,3-benzoxazol-4-ol.
What is the SMILES notation for 2-propan-2-yloxy-1,3-benzoxazol-4-ol?
The canonical SMILES for 2-propan-2-yloxy-1,3-benzoxazol-4-ol is CC(C)Oc1nc2c(O)cccc2o1.
What is the InChIKey of 2-propan-2-yloxy-1,3-benzoxazol-4-ol?
The InChIKey is WWLNKFBOFGZBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-6(2)13-10-11-9-7(12)4-3-5-8(9)14-10/h3-6,12H,1-2H3.
What are the key properties of 2-propan-2-yloxy-1,3-benzoxazol-4-ol?
2-propan-2-yloxy-1,3-benzoxazol-4-ol has a molecular weight of 193.20 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxy-1,3-benzoxazol-4-ol is sourced from PubChem (CID 166456971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).